Difference between revisions of "RXN-15881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15881 RXN-15881] == * direction: ** LEFT-TO-RIGHT * common name: ** Aminotransferase class V do...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15881 RXN-15881] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C=CC([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
+
 
* common name:
 
* common name:
−
** maleate
+
** Aminotransferase class V domain
−
* molecular weight:
+
** Cysteine desulfurase
−
** 114.057   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
−
** maleic acid
 
−
** cis-butenedioic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-646]]
+
** 1 [[L-Cysteine-Desulfurases]][c] '''+''' 1 [[CYS]][c] '''=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[Persulfurated-L-cysteine-desulfurases]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an [L-cysteine desulfurase][c] '''+''' 1 L-cysteine[c] '''=>''' 1 L-alanine[c] '''+''' 1 an S-sulfanyl-[L-cysteine desulfurase][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_005640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-22_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-21_003740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
 +
** '''10''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 110-16-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Aminotransferase class V domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
+
{{#set: common name=Cysteine desulfurase}}
−
* HMDB : HMDB00176
+
{{#set: ec number=EC-2.8.1.7}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-21_005640|Ec-22_000950|Ec-21_003740}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
+
{{#set: in pathway=PWY-7250}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
+
−
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
+
−
{{#set: common name=maleate}}
+
−
{{#set: molecular weight=114.057    }}
+
−
{{#set: common name=maleic acid|cis-butenedioic acid}}
+
−
{{#set: produced by=RXN-646}}
+

Latest revision as of 19:50, 21 March 2018

Reaction RXN-15881

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Aminotransferase class V domain
    • Cysteine desulfurase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7250, [2Fe-2S] iron-sulfur cluster biosynthesis: PWY-7250
    • 10 reactions found over 10 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15881&oldid=29687"