Difference between revisions of "CPD-14901"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLULOSE CELLULOSE] == * common name: ** cellulose * Synonym(s): ** (1,4-β-D-glucosyl)(N)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == |
| + | * smiles: | ||
| + | ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** poriferst-7-enol |
| + | * molecular weight: | ||
| + | ** 414.713 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 22-dihydrochondrillasterol |
| + | ** 24β-ethylcholest-7-en-3β-ol | ||
| + | ** chondrillast-7-enol | ||
| + | ** dihydrochondrillasterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13892]] | |
| − | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 18525-35-4 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12315364 12315364] |
| − | {{#set: | + | {{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| + | {{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}} | ||
| + | {{#set: common name=poriferst-7-enol}} | ||
| + | {{#set: molecular weight=414.713 }} | ||
| + | {{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}} | ||
| + | {{#set: consumed by=RXN-13892}} | ||
Latest revision as of 20:50, 21 March 2018
Contents
Metabolite CPD-14901
- smiles:
- CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
- common name:
- poriferst-7-enol
- molecular weight:
- 414.713
- Synonym(s):
- 22-dihydrochondrillasterol
- 24β-ethylcholest-7-en-3β-ol
- chondrillast-7-enol
- dihydrochondrillasterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 18525-35-4
- PUBCHEM:
"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
