Difference between revisions of "MALEATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Succi...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C([O-])(=O)C=CC([O-])=O
 +
* inchi key:
 +
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
 
* common name:
 
* common name:
** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
+
** maleate
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.4.3.16 EC-1.4.3.16]
+
** 114.057   
 
* Synonym(s):
 
* Synonym(s):
 +
** maleic acid
 +
** cis-butenedioic acid
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[L-ASPARTATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[IMINOASPARTATE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
* [[RXN-646]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 L-aspartate[c] '''+''' 1 oxygen[c] '''=>''' 1 H+[c] '''+''' 1 2-iminosuccinate[c] '''+''' 1 hydrogen peroxide[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-05_003640]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
== Pathways  ==
+
* [[PWY-5316]], nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5316 PWY-5316]
+
** '''3''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-7342]], superpathway of nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7342 PWY-7342]
+
** '''4''' reactions found over '''13''' reactions in the full pathway
+
* [[PYRIDNUCSYN-PWY]], NAD biosynthesis I (from aspartate): [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY]
+
** '''6''' reactions found over '''6''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* CAS : 110-16-7
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25876 25876]
+
* PUBCHEM:
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
** [http://www.genome.jp/dbget-bin/www_bget?R00481 R00481]
+
* HMDB : HMDB00176
** [http://www.genome.jp/dbget-bin/www_bget?R00357 R00357]
+
* LIGAND-CPD:
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
{{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}}
+
* CHEMSPIDER:
{{#set: ec number=EC-1.4.3.16}}
+
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
{{#set: gene associated=Ec-05_003640}}
+
* CHEBI:
{{#set: in pathway=PWY-5316|PWY-7342|PYRIDNUCSYN-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=maleate}}
 +
{{#set: molecular weight=114.057    }}
 +
{{#set: common name=maleic acid|cis-butenedioic acid}}
 +
{{#set: produced by=RXN-646}}

Latest revision as of 20:50, 21 March 2018

Metabolite MALEATE

  • smiles:
    • C([O-])(=O)C=CC([O-])=O
  • inchi key:
    • InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
  • common name:
    • maleate
  • molecular weight:
    • 114.057
  • Synonym(s):
    • maleic acid
    • cis-butenedioic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C=CC([O-])=O" cannot be used as a page name in this wiki.