Difference between revisions of "RXN-2541"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == * smiles: ** CC(C)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2541 RXN-2541] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2541 RXN-2541] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N
+
** [http://enzyme.expasy.org/EC/2.5.1.115 EC-2.5.1.115]
−
* common name:
+
−
** 5α-cholesta-7,24-dien-3β-ol
+
−
* molecular weight:
+
−
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11887]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[HOMOGENTISATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[MPBQ]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 phytyl diphosphate[c] '''+''' 1 H+[c] '''+''' 1 homogentisate[c] '''=>''' 1 CO2[c] '''+''' 1 diphosphate[c] '''+''' 1 2-methyl-6-phytyl-1,4-benzoquinol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_000990]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-1422]], vitamin E biosynthesis (tocopherols): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1422 PWY-1422]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459827 5459827]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07500 R07500]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16290 16290]
+
{{#set: ec number=EC-2.5.1.115}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-21_000990}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05439 C05439]
+
{{#set: in pathway=PWY-1422}}
−
* HMDB : HMDB06842
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: inchi key=InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=5α-cholesta-7,24-dien-3β-ol}}
+
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: consumed by=RXN-11887}}
+

Latest revision as of 19:50, 21 March 2018

Reaction RXN-2541

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-1422, vitamin E biosynthesis (tocopherols): PWY-1422
    • 7 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-2541&oldid=29711"