Difference between revisions of "Ec-20 004950"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * smiles: ** C[N+](CCOP([O-])([O-])=O)(C)C * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-20_004950 == * left end position: ** 4967773 * transcription direction: ** NEGATIVE * right end position: ** 4971477 * centisome position: ** 96.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_004950 == |
− | * | + | * left end position: |
− | ** | + | ** 4967773 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4971477 |
− | * | + | * centisome position: |
− | ** | + | ** 96.34149 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0231_0013 |
− | ** | + | ** Esi0231_0013 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DTMPKI-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-7210]] | |
+ | * [[PWY-7198]] | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7187]] | ||
+ | * [[PWY-7197]] | ||
+ | * [[PWY0-166]] | ||
+ | * [[PWY-6545]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4967773}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4971477}} | |
− | + | {{#set: centisome position=96.34149 }} | |
− | + | {{#set: common name=Esi_0231_0013|Esi0231_0013}} | |
− | + | {{#set: reaction associated=DTMPKI-RXN}} | |
− | + | {{#set: pathway associated=PWY-7210|PWY-7198|PWY-7184|PWY-7187|PWY-7197|PWY0-166|PWY-6545}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:50, 21 March 2018
Gene Ec-20_004950
- left end position:
- 4967773
- transcription direction:
- NEGATIVE
- right end position:
- 4971477
- centisome position:
- 96.34149
- Synonym(s):
- Esi_0231_0013
- Esi0231_0013
Reactions associated
- Reaction: DTMPKI-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome