Difference between revisions of "COBINAMIDE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_003900 == * left end position: ** 3805141 * transcription direction: ** NEGATIVE * right end position: ** 3810549 * centisome position: ** 77.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == * smiles: ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M |
| − | * | + | * common name: |
| − | ** | + | ** cobinamide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 990.096 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Cbi |
| − | ** | + | ** cobyrinic acid a,c-diamide |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[BTUR2-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 1867-62-5 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010] |
| − | {{#set: | + | * HMDB : HMDB06902 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05774 C05774] | |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956] | ||
| + | * BIGG : 46472 | ||
| + | {{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}} | ||
| + | {{#set: inchi key=InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M}} | ||
| + | {{#set: common name=cobinamide}} | ||
| + | {{#set: molecular weight=990.096 }} | ||
| + | {{#set: common name=Cbi|cobyrinic acid a,c-diamide}} | ||
| + | {{#set: consumed by=BTUR2-RXN}} | ||
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite COBINAMIDE
- smiles:
- CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
- inchi key:
- InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
- common name:
- cobinamide
- molecular weight:
- 990.096
- Synonym(s):
- Cbi
- cobyrinic acid a,c-diamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))" cannot be used as a page name in this wiki.
