Difference between revisions of "Ec-26 002300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...")
(Created page with "Category:Gene == Gene Ec-26_002300 == * left end position: ** 2659614 * transcription direction: ** POSITIVE * right end position: ** 2669310 * centisome position: ** 40.3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] ==
+
== Gene Ec-26_002300 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 2659614
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** 2669310
−
* molecular weight:
+
* centisome position:
−
** 1118.034    
+
** 40.39911    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
+
** Esi_0274_0001
 +
** Esi0274_0001
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17116]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17115]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: left end position=2659614}}
−
{{#set: inchi key=InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: right end position=2669310}}
−
{{#set: molecular weight=1118.034   }}
+
{{#set: centisome position=40.39911   }}
−
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
{{#set: common name=Esi_0274_0001|Esi0274_0001}}
−
{{#set: consumed by=RXN-17116}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: produced by=RXN-17115}}
+

Latest revision as of 19:51, 21 March 2018

Gene Ec-26_002300

  • left end position:
    • 2659614
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2669310
  • centisome position:
    • 40.39911
  • Synonym(s):
    • Esi_0274_0001
    • Esi0274_0001

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_002300&oldid=29852"