Difference between revisions of "3Z-PHYCOERYTHROBILIN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_000810 == * left end position: ** 784882 * transcription direction: ** POSITIVE * right end position: ** 795758 * centisome position: ** 15.931...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == |
− | * | + | * smiles: |
− | ** | + | ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L |
− | * | + | * common name: |
− | ** | + | ** (3Z)-phycoerythrobilin |
− | * | + | * molecular weight: |
− | ** | + | ** 584.671 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[1.3.7.3-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438] |
− | {{#set: | + | {{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}} |
+ | {{#set: common name=(3Z)-phycoerythrobilin}} | ||
+ | {{#set: molecular weight=584.671 }} | ||
+ | {{#set: produced by=1.3.7.3-RXN}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite 3Z-PHYCOERYTHROBILIN
- smiles:
- CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- inchi key:
- InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
- common name:
- (3Z)-phycoerythrobilin
- molecular weight:
- 584.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.