Difference between revisions of "CPD-698"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN] == * direction: ** LEFT-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
 
* common name:
 
* common name:
−
** Pyridoxal-dependent decarboxylase
+
** campest-4-en-3-one
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.1.2.27 EC-4.1.2.27]
+
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
 +
** methylcholestenone
 +
** (24R)-24-methyl-cholest-4-en-3-one
 +
** 3-dehydro-Δ4-5-campesterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-711]]
−
** 1 [[CPD-649]][c] '''=>''' 1 [[PHOSPHORYL-ETHANOLAMINE]][c] '''+''' 1 [[PALMITALDEHYDE]][c]
+
* [[RXN-4231]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 sphinganine 1-phosphate[c] '''=>''' 1 O-phosphoethanolamine[c] '''+''' 1 palmitaldehyde[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-03_002920]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7119]], sphingolipid recycling and degradation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7119 PWY-7119]
+
−
** '''4''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18594 18594]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612]
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02464 R02464]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB12196
−
{{#set: common name=Pyridoxal-dependent decarboxylase}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: ec number=EC-4.1.2.27}}
+
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
−
{{#set: gene associated=Ec-03_002920}}
+
{{#set: common name=campest-4-en-3-one}}
−
{{#set: in pathway=PWY-7119}}
+
{{#set: molecular weight=398.671    }}
−
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
{{#set: consumed by=RXN-711|RXN-4231}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite CPD-698

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
  • common name:
    • campest-4-en-3-one
  • molecular weight:
    • 398.671
  • Synonym(s):
    • methylcholestenone
    • (24R)-24-methyl-cholest-4-en-3-one
    • 3-dehydro-Δ4-5-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-698&oldid=30045"