Difference between revisions of "Ec-10 002950"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-10_002950 == * left end position: ** 3023280 * transcription direction: ** POSITIVE * right end position: ** 3032739 * centisome position: ** 46.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_002950 == |
− | * | + | * left end position: |
− | ** | + | ** 3023280 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3032739 |
− | * | + | * centisome position: |
− | ** | + | ** 46.504955 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0174_0057 |
− | ** | + | ** Esi0174_0057 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RIBOFLAVINKIN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY66-366]] | ||
+ | * [[PWY-6168]] | ||
+ | * [[RIBOSYN2-PWY]] | ||
+ | * [[PWY-5523]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3023280}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3032739}} | |
− | {{#set: | + | {{#set: centisome position=46.504955 }} |
− | {{#set: | + | {{#set: common name=Esi_0174_0057|Esi0174_0057}} |
− | {{#set: | + | {{#set: reaction associated=RIBOFLAVINKIN-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY66-366|PWY-6168|RIBOSYN2-PWY|PWY-5523}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:53, 21 March 2018
Gene Ec-10_002950
- left end position:
- 3023280
- transcription direction:
- POSITIVE
- right end position:
- 3032739
- centisome position:
- 46.504955
- Synonym(s):
- Esi_0174_0057
- Esi0174_0057
Reactions associated
- Reaction: RIBOFLAVINKIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome