Difference between revisions of "Trans-D2-decenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D2-decenoyl-ACPs Trans-D2-decenoyl-ACPs] == * common name: ** a (2E)-dec-2-enoyl-[acp] *...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D2-decenoyl-ACPs Trans-D2-decenoyl-ACPs] ==
−
* smiles:
+
−
** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
+
−
* inchi key:
+
−
** InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
+
 
* common name:
 
* common name:
−
** 1-oleoyl-2-lyso-glycerone phosphate
+
** a (2E)-dec-2-enoyl-[acp]
−
* molecular weight:
+
−
** 432.493   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-oleoyl-2-lyso-dihydroxyacetone phosphate
+
** a trans-Δ2-decenoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15046]]
+
* [[RXN-9660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-15044]]
+
* [[RXN-9655]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[5.3.3.14-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a (2E)-dec-2-enoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289257 86289257]
+
{{#set: common name=a trans-Δ2-decenoyl-[acp]}}
−
* CHEBI:
+
{{#set: consumed by=RXN-9660}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492]
+
{{#set: produced by=RXN-9655}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}}
+
{{#set: reversible reaction associated=5.3.3.14-RXN}}
−
{{#set: inchi key=InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L}}
+
−
{{#set: common name=1-oleoyl-2-lyso-glycerone phosphate}}
+
−
{{#set: molecular weight=432.493    }}
+
−
{{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}}
+
−
{{#set: consumed by=RXN-15046}}
+
−
{{#set: produced by=RXN-15044}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite Trans-D2-decenoyl-ACPs

  • common name:
    • a (2E)-dec-2-enoyl-[acp]
  • Synonym(s):
    • a trans-Δ2-decenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (2E)-dec-2-enoyl-[acp" cannot be used as a page name in this wiki.
"a trans-Δ2-decenoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Trans-D2-decenoyl-ACPs&oldid=30065"