Difference between revisions of "4-CYTIDINE-5-DIPHOSPHO-2-C"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-23_002330 == * left end position: ** 2462540 * transcription direction: ** POSITIVE * right end position: ** 2477190 * centisome position: ** 50.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == * smiles: ** CC(O)(CO)C(O)COP(OP([O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == |
− | * | + | * smiles: |
− | ** | + | ** CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L |
− | * | + | * common name: |
− | ** | + | ** 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol |
− | * | + | * molecular weight: |
− | ** | + | ** 519.295 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** CDP-ME |
− | ** | + | ** CDP-methyl-D-erythritol |
+ | ** 4-diphosphocytidyl-2C-methyl-D-erythritol | ||
+ | ** 4-diphosphocytidyl-2-C-methylerythritol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.7.1.148-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.7.7.60-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24970669 24970669] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57823 57823] |
− | {{#set: common name= | + | * BIGG : 216317 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11435 C11435] |
+ | {{#set: smiles=CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L}} | ||
+ | {{#set: common name=4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}} | ||
+ | {{#set: molecular weight=519.295 }} | ||
+ | {{#set: common name=CDP-ME|CDP-methyl-D-erythritol|4-diphosphocytidyl-2C-methyl-D-erythritol|4-diphosphocytidyl-2-C-methylerythritol}} | ||
+ | {{#set: consumed by=2.7.1.148-RXN}} | ||
+ | {{#set: produced by=2.7.7.60-RXN}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C
- smiles:
- CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O
- inchi key:
- InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L
- common name:
- 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
- molecular weight:
- 519.295
- Synonym(s):
- CDP-ME
- CDP-methyl-D-erythritol
- 4-diphosphocytidyl-2C-methyl-D-erythritol
- 4-diphosphocytidyl-2-C-methylerythritol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O" cannot be used as a page name in this wiki.