Difference between revisions of "Ec-18 003270"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-18_003270 == * left end position: ** 3312595 * transcription direction: ** NEGATIVE * right end position: ** 3320538 * centisome position: ** 67.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_003270 == |
− | * | + | * left end position: |
− | ** | + | ** 3312595 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3320538 |
− | * | + | * centisome position: |
− | ** | + | ** 67.239555 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0022_0162 |
− | ** | + | ** Esi0022_0162 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[P562-PWY]] | ||
+ | * [[PWY-7241]] | ||
+ | * [[PWY-7237]] | ||
+ | * [[PWY-5940]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3312595}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3320538}} | |
− | + | {{#set: centisome position=67.239555 }} | |
− | + | {{#set: common name=Esi_0022_0162|Esi0022_0162}} | |
− | + | {{#set: reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}} | |
− | + | {{#set: pathway associated=P562-PWY|PWY-7241|PWY-7237|PWY-5940}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:53, 21 March 2018
Gene Ec-18_003270
- left end position:
- 3312595
- transcription direction:
- NEGATIVE
- right end position:
- 3320538
- centisome position:
- 67.239555
- Synonym(s):
- Esi_0022_0162
- Esi0022_0162
Reactions associated
- Reaction: MYO-INOSITOL-2-DEHYDROGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome