Difference between revisions of "CPD-17624"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-16_005090 == * left end position: ** 5219590 * transcription direction: ** NEGATIVE * right end position: ** 5225318 * centisome position: ** 97.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I |
| − | * | + | * common name: |
| − | ** | + | ** ω-carboxy-(9Z)-octadec-9-enoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1056.928 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 18-carboxyl oleoyl-CoA |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-16418]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820430 91820430] |
| − | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I}} |
| − | {{#set: common name= | + | {{#set: common name=ω-carboxy-(9Z)-octadec-9-enoyl-CoA}} |
| − | + | {{#set: molecular weight=1056.928 }} | |
| − | {{#set: | + | {{#set: common name=18-carboxyl oleoyl-CoA}} |
| + | {{#set: produced by=RXN-16418}} | ||
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-17624
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
- common name:
- ω-carboxy-(9Z)-octadec-9-enoyl-CoA
- molecular weight:
- 1056.928
- Synonym(s):
- 18-carboxyl oleoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
