Difference between revisions of "RXN0-722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate re...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] ==
−
* smiles:
+
* direction:
−
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
−
** bupropion
+
** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
−
* molecular weight:
+
** EsV-1-128
−
** 240.752   
+
** EsV-1-180
 +
** Ribonucleoside-diphosphate reductase small chain
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
 
−
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
 
−
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
 
−
** amfebutamonum
 
−
** α-(tert-butylamino)-m-chloropropiophenone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-181]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[UDP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[DUDP]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 UDP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 dUDP[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-19_000440]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-11_002170]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_005570]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-21_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_005120]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
 +
** '''14''' reactions found over '''17''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01156
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
+
{{#set: common name=EsV-1-128}}
−
* CHEBI:
+
{{#set: common name=EsV-1-180}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
+
{{#set: common name=Ribonucleoside-diphosphate reductase small chain}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.17.4.1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
+
{{#set: gene associated=Ec-19_000440|Ec-11_002170|Ec-06_005570|Ec-21_002920|Ec-06_005120}}
−
* HMDB : HMDB01510
+
{{#set: in pathway=PWY0-166}}
−
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=bupropion}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=240.752    }}
+
−
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
+
−
{{#set: consumed by=RXN66-181}}
+

Latest revision as of 19:54, 21 March 2018

Reaction RXN0-722

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
    • EsV-1-128
    • EsV-1-180
    • Ribonucleoside-diphosphate reductase small chain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-166, superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): PWY0-166
    • 14 reactions found over 17 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-722&oldid=30184"