Difference between revisions of "COUMARALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate re...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARALDEHYDE COUMARALDEHYDE] == * smiles: ** C(=O)C=CC1(C=CC(O)=CC=1) * inchi key: ** InChIKe...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARALDEHYDE COUMARALDEHYDE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)C=CC1(C=CC(O)=CC=1)
 +
* inchi key:
 +
** InChIKey=CJXMVKYNVIGQBS-OWOJBTEDSA-N
 
* common name:
 
* common name:
−
** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
+
** 4-coumaraldehyde
−
** EsV-1-128
+
* molecular weight:
−
** EsV-1-180
+
** 148.161   
−
** Ribonucleoside-diphosphate reductase small chain
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** coumaraldehyde
 +
** p-coumaraldehyde
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-1102]]
−
** 1 [[UDP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[DUDP]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-1101]]
−
** 1 UDP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 dUDP[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-19_000440]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-11_002170]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-06_005570]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-21_002920]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-06_005120]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
+
−
** '''14''' reactions found over '''17''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=641301 641301]
−
{{#set: common name=EsV-1-128}}
+
* HMDB : HMDB40986
−
{{#set: common name=EsV-1-180}}
+
* LIGAND-CPD:
−
{{#set: common name=Ribonucleoside-diphosphate reductase small chain}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05608 C05608]
−
{{#set: ec number=EC-1.17.4.1}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Ec-19_000440|Ec-11_002170|Ec-06_005570|Ec-21_002920|Ec-06_005120}}
+
** [http://www.chemspider.com/Chemical-Structure.556592.html 556592]
−
{{#set: in pathway=PWY0-166}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28353 28353]
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* METABOLIGHTS : MTBLC28353
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C(=O)C=CC1(C=CC(O)=CC=1)}}
 +
{{#set: inchi key=InChIKey=CJXMVKYNVIGQBS-OWOJBTEDSA-N}}
 +
{{#set: common name=4-coumaraldehyde}}
 +
{{#set: molecular weight=148.161    }}
 +
{{#set: common name=coumaraldehyde|p-coumaraldehyde}}
 +
{{#set: consumed by=RXN-1102}}
 +
{{#set: produced by=RXN-1101}}

Latest revision as of 19:55, 21 March 2018

Metabolite COUMARALDEHYDE

  • smiles:
    • C(=O)C=CC1(C=CC(O)=CC=1)
  • inchi key:
    • InChIKey=CJXMVKYNVIGQBS-OWOJBTEDSA-N
  • common name:
    • 4-coumaraldehyde
  • molecular weight:
    • 148.161
  • Synonym(s):
    • coumaraldehyde
    • p-coumaraldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=COUMARALDEHYDE&oldid=30265"