Difference between revisions of "Ec-15 001600"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)C...")
(Created page with "Category:Gene == Gene Ec-15_001600 == * left end position: ** 1810960 * transcription direction: ** NEGATIVE * right end position: ** 1833163 * centisome position: ** 33.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] ==
+
== Gene Ec-15_001600 ==
−
* smiles:
+
* left end position:
−
** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** 1810960
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** 1833163
−
* molecular weight:
+
* centisome position:
−
** 842.848    
+
** 33.54715    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP
+
** Esi_0056_0068
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione
+
** Esi0056_0068
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15681]]
+
* Reaction: [[5.99.1.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-15680]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[5.99.1.3-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1810960}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657797 90657797]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
{{#set: right end position=1833163}}
−
{{#set: inchi key=InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L}}
+
{{#set: centisome position=33.54715   }}
−
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common name=Esi_0056_0068|Esi0056_0068}}
−
{{#set: molecular weight=842.848   }}
+
{{#set: reaction associated=5.99.1.2-RXN|5.99.1.3-RXN}}
−
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
−
{{#set: consumed by=RXN-15681}}
+
−
{{#set: produced by=RXN-15680}}
+

Latest revision as of 19:55, 21 March 2018

Gene Ec-15_001600

  • left end position:
    • 1810960
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1833163
  • centisome position:
    • 33.54715
  • Synonym(s):
    • Esi_0056_0068
    • Esi0056_0068

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_001600&oldid=30308"