Difference between revisions of "CPD-7100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-23 RXN66-23] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-beta hydroxysteroid dehydro...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-23 RXN66-23] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
 +
* inchi key:
 +
** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
 
* common name:
 
* common name:
−
** 3-beta hydroxysteroid dehydrogenase/isomerase
+
** (2S)-2-isopropyl-3-oxosuccinate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.170 EC-1.1.1.170]
+
** 172.137   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-isopropyl-3-oxosuccinate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7800]]
−
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-8619]][c] '''=>''' 1 [[CPD-8620]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD(P)+[c] '''+''' 1 4α-carboxy-5α-cholesta-8-en-3β-ol[c] '''=>''' 1 5α-cholesta-8-en-3-one[c] '''+''' 1 CO2[c] '''+''' 1 NAD(P)H[c]
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-21_001850]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
+
−
** '''9''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=3-beta hydroxysteroid dehydrogenase/isomerase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236]
−
{{#set: ec number=EC-1.1.1.170}}
+
* CHEBI:
−
{{#set: gene associated=Ec-21_001850}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214]
−
{{#set: in pathway=PWY66-3}}
+
* BIGG : 43420
−
{{#set: reconstruction category=annotation}}
+
* PUBCHEM:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB12149
 +
{{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}}
 +
{{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}}
 +
{{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}}
 +
{{#set: molecular weight=172.137    }}
 +
{{#set: common name=2-isopropyl-3-oxosuccinate}}
 +
{{#set: consumed by=RXN-7800}}
 +
{{#set: reversible reaction associated=3-ISOPROPYLMALDEHYDROG-RXN}}

Latest revision as of 19:55, 21 March 2018

Metabolite CPD-7100

  • smiles:
    • CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
  • inchi key:
    • InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
  • common name:
    • (2S)-2-isopropyl-3-oxosuccinate
  • molecular weight:
    • 172.137
  • Synonym(s):
    • 2-isopropyl-3-oxosuccinate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(C(=O)[O-])C(=O)C(=O)[O-])C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7100&oldid=30312"