Difference between revisions of "ISOLEUCINE--TRNA-LIGASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == * smiles: ** CC1(OC(O[R])C(O)C(O)C(O)1) * common na...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOLEUCINE--TRNA-LIGASE-RXN ISOLEUCINE--TRNA-LIGASE-RXN] == * direction: ** LEFT-TO-RIGHT * common...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOLEUCINE--TRNA-LIGASE-RXN ISOLEUCINE--TRNA-LIGASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** Isoleucyl-tRNA Synthetase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/6.1.1.5 EC-6.1.1.5] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ILE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[ILE-tRNAs]][c] '''=>''' 1 [[Charged-ILE-tRNAs]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 L-isoleucine[c] '''+''' 1 H+[c] '''+''' 1 ATP[c] '''+''' 1 a tRNAile[c] '''=>''' 1 an L-isoleucyl-[tRNAile][c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-12_001710]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-06_008740]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | ||
+ | ** '''21''' reactions found over '''21''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * RHEA: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11060 11060] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03656 R03656] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P18330 P18330] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P36422 P36422] |
+ | ** [http://www.uniprot.org/uniprot/O29622 O29622] | ||
+ | ** [http://www.uniprot.org/uniprot/P47587 P47587] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZCU4 Q9ZCU4] | ||
+ | ** [http://www.uniprot.org/uniprot/P46213 P46213] | ||
+ | ** [http://www.uniprot.org/uniprot/P41257 P41257] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JVY4 Q9JVY4] | ||
+ | ** [http://www.uniprot.org/uniprot/Q58357 Q58357] | ||
+ | ** [http://www.uniprot.org/uniprot/O83466 O83466] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9Z972 Q9Z972] | ||
+ | ** [http://www.uniprot.org/uniprot/P56456 P56456] | ||
+ | ** [http://www.uniprot.org/uniprot/O58792 O58792] | ||
+ | ** [http://www.uniprot.org/uniprot/O84022 O84022] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZJJ1 Q9ZJJ1] | ||
+ | ** [http://www.uniprot.org/uniprot/O66651 O66651] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9CEH8 Q9CEH8] | ||
+ | ** [http://www.uniprot.org/uniprot/O27428 O27428] | ||
+ | ** [http://www.uniprot.org/uniprot/Q45477 Q45477] | ||
+ | ** [http://www.uniprot.org/uniprot/O51773 O51773] | ||
+ | ** [http://www.uniprot.org/uniprot/P46207 P46207] | ||
+ | ** [http://www.uniprot.org/uniprot/P41252 P41252] | ||
+ | ** [http://www.uniprot.org/uniprot/P41972 P41972] | ||
+ | ** [http://www.uniprot.org/uniprot/P48526 P48526] | ||
+ | ** [http://www.uniprot.org/uniprot/P75258 P75258] | ||
+ | ** [http://www.uniprot.org/uniprot/P73505 P73505] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49024 Q49024] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49074 Q49074] | ||
+ | ** [http://www.uniprot.org/uniprot/P43824 P43824] | ||
+ | ** [http://www.uniprot.org/uniprot/P09436 P09436] | ||
+ | ** [http://www.uniprot.org/uniprot/P00956 P00956] | ||
+ | ** [http://www.uniprot.org/uniprot/Q94425 Q94425] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Isoleucyl-tRNA Synthetase}} | ||
+ | {{#set: ec number=EC-6.1.1.5}} | ||
+ | {{#set: gene associated=Ec-12_001710|Ec-06_008740}} | ||
+ | {{#set: in pathway=TRNA-CHARGING-PWY}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:56, 21 March 2018
Contents
Reaction ISOLEUCINE--TRNA-LIGASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Isoleucyl-tRNA Synthetase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 L-isoleucine[c] + 1 H+[c] + 1 ATP[c] + 1 a tRNAile[c] => 1 an L-isoleucyl-[tRNAile][c] + 1 diphosphate[c] + 1 AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_001710
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_008740
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- TRNA-CHARGING-PWY, tRNA charging: TRNA-CHARGING-PWY
- 21 reactions found over 21 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: