Difference between revisions of "CPD-4578"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Ser-or-Thr-phosphate Protein-Ser-or-Thr-phosphate] == * common name: ** a [protein] (L-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4578 CPD-4578] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4578 CPD-4578] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-dehydro-4-methylzymosterol |
| + | * molecular weight: | ||
| + | ** 396.655 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4α-methyl-5α-cholesta-8,24-dien-3-one | ||
| + | ** 3-keto-4-methylzymosterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-313]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15816 C15816] |
| − | {{#set: produced by= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50593 50593] | ||
| + | * METABOLIGHTS : MTBLC50593 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298939 22298939] | ||
| + | * HMDB : HMDB06838 | ||
| + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N}} | ||
| + | {{#set: common name=3-dehydro-4-methylzymosterol}} | ||
| + | {{#set: molecular weight=396.655 }} | ||
| + | {{#set: common name=4α-methyl-5α-cholesta-8,24-dien-3-one|3-keto-4-methylzymosterol}} | ||
| + | {{#set: produced by=RXN66-313}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite CPD-4578
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N
- common name:
- 3-dehydro-4-methylzymosterol
- molecular weight:
- 396.655
- Synonym(s):
- 4α-methyl-5α-cholesta-8,24-dien-3-one
- 3-keto-4-methylzymosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
