Difference between revisions of "RXN-13519"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
−
** InChIKey=VWFJDQUYCIWHTN-YFVJMOTDSA-K
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** (2E,6E)-farnesyl diphosphate
+
** trans-lycopene biosynthesis II (plants)
−
* molecular weight:
+
−
** 379.306   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-trans,6-trans-farnesyl diphosphate
 
−
** FPP
 
−
** trans, trans-farnesyl diphosphate
 
−
** farnesyl-PP
 
−
** farnesyl pyrophosphate
 
−
** ω,E,E-farnesyl diphosphate
 
−
** farnesyl diphosphate
 
−
** (E,E)-farnesyl diphosphate
 
−
** all-trans-farnesyl diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-8999]]
+
'''4''' reactions found over '''8''' reactions in the full pathway
−
* [[RXN-13162]]
+
* [[2.5.1.32-RXN]]
−
* [[RXN-17573]]
+
** 1 associated gene(s):
−
* [[RXN-12263]]
+
*** [[Ec-04_002810]]
−
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
** 1 reconstruction source(s) associated:
−
== Reaction(s) known to produce the compound ==
+
*** [[annotation-esiliculosus_genome]]
−
* [[FPPSYN-RXN]]
+
* [[RXN-11356]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
−
* [[2.5.1.58-RXN]]
+
*** [[Ec-02_004660]]
−
* [[RXN0-5180]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11357]]
 +
** 1 associated gene(s):
 +
*** [[Ec-02_004660]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXNARA-8002]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_002810]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11354 RXN-11354]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12243 RXN-12243]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12244 RXN-12244]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8042 RXN-8042]
 
== External links  ==
 
== External links  ==
−
* CAS : 13058-04-3
+
* PLANTCYC : PWY-6475
−
* BIGG : 35006
+
{{#set: taxonomic range=TAX-1117}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2763}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15983959 15983959]
+
{{#set: taxonomic range=TAX-33090}}
−
* KNAPSACK : C00007268
+
{{#set: common name=trans-lycopene biosynthesis II (plants)}}
−
* HMDB : HMDB00961
+
{{#set: reaction found=4}}
−
* LIGAND-CPD:
+
{{#set: total reaction=8}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00448 C00448]
+
{{#set: completion rate=50.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.11633047.html 11633047]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=175763 175763]
+
−
* METABOLIGHTS : MTBLC175763
+
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C}}
+
−
{{#set: inchi key=InChIKey=VWFJDQUYCIWHTN-YFVJMOTDSA-K}}
+
−
{{#set: common name=(2E,6E)-farnesyl diphosphate}}
+
−
{{#set: molecular weight=379.306    }}
+
−
{{#set: common name=2-trans,6-trans-farnesyl diphosphate|FPP|trans, trans-farnesyl diphosphate|farnesyl-PP|farnesyl pyrophosphate|ω,E,E-farnesyl diphosphate|farnesyl diphosphate|(E,E)-farnesyl diphosphate|all-trans-farnesyl diphosphate}}
+
−
{{#set: consumed by=RXN-8999|RXN-13162|RXN-17573|RXN-12263|FARNESYLTRANSTRANSFERASE-RXN}}
+
−
{{#set: produced by=FPPSYN-RXN}}
+
−
{{#set: consumed or produced by=2.5.1.58-RXN|RXN0-5180}}
+

Revision as of 20:22, 17 March 2018

Pathway PWY-6475

Reaction(s) found

4 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

  • PLANTCYC : PWY-6475




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13519&oldid=8624"