Difference between revisions of "CPD-17324"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-150 RXN1F-150] == * direction: ** LEFT-TO-RIGHT * common name: ** lycopene beta cyclase * ec...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-150 RXN1F-150] ==
−
* smiles:
+
* direction:
−
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
+
 
* common name:
 
* common name:
−
** 5-enolpyruvoyl-shikimate 3-phosphate
+
** lycopene beta cyclase
−
* molecular weight:
+
* ec number:
−
** 320.149   
+
** [http://enzyme.expasy.org/EC/5.5.1.19 EC-5.5.1.19]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-enolpyruvyl-shikimate 5-phosphate
 
−
** 3-enolpyruvyl-shikimate-5-P
 
−
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
 
−
** 5-enolpyruvyl-shikimate 3-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[CHORISMATE-SYNTHASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD1F-114]][c] '''=>''' 1 [[CPD1F-126]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[2.5.1.19-RXN]]
+
** 1 all-trans-lycopene[c] '''=>''' 1 γ-carotene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-00_005820]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-07_007260]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-00_005850]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-24_002150]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-02_005510]]
 +
** ESILICULOSUS_GENOME
 +
***GO-TERM
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-10_006240]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-24_002140]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways  ==
 +
* [[PWY-5943]], β-carotene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5943 PWY-5943]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-7591]], okenone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7591 PWY-7591]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32222 32222]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05341 R05341]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
+
{{#set: common name=lycopene beta cyclase}}
−
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
+
{{#set: ec number=EC-5.5.1.19}}
−
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
+
{{#set: gene associated=Ec-00_005820|Ec-07_007260|Ec-00_005850|Ec-24_002150|Ec-02_005510|Ec-10_006240|Ec-24_002140}}
−
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
+
{{#set: in pathway=PWY-5943|PWY-7591}}
−
{{#set: molecular weight=320.149    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed or produced by=2.5.1.19-RXN}}
+

Revision as of 20:55, 17 March 2018

Reaction RXN1F-150

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • lycopene beta cyclase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 all-trans-lycopene[c] => 1 γ-carotene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5943, β-carotene biosynthesis: PWY-5943
    • 2 reactions found over 2 reactions in the full pathway
  • PWY-7591, okenone biosynthesis: PWY-7591
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-17324&oldid=10902"