Difference between revisions of "Ec-20 000870"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-20_000870 == * left end position: ** 812200 * transcription direction: ** POSITIVE * right end position: ** 817933 * centisome position: ** 15.751...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_000870 == |
− | * | + | * left end position: |
− | ** | + | ** 812200 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 817933 |
− | * | + | * centisome position: |
− | ** | + | ** 15.751235 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0195_0011 |
+ | ** Esi0195_0011 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | * | + | == Pathways associated == |
− | * [[ | + | |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=812200}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=817933}} | |
− | + | {{#set: centisome position=15.751235 }} | |
− | + | {{#set: common name=Esi_0195_0011|Esi0195_0011}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:57, 21 March 2018
Gene Ec-20_000870
- left end position:
- 812200
- transcription direction:
- POSITIVE
- right end position:
- 817933
- centisome position:
- 15.751235
- Synonym(s):
- Esi_0195_0011
- Esi0195_0011
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome