Difference between revisions of "Ec-01 007120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
(Created page with "Category:Gene == Gene Ec-01_007120 == * left end position: ** 6098898 * transcription direction: ** NEGATIVE * right end position: ** 6101283 * centisome position: ** 59.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
+
== Gene Ec-01_007120 ==
−
* smiles:
+
* left end position:
−
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
+
** 6098898
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-hydroxyferulate
+
** 6101283
−
* molecular weight:
+
* centisome position:
−
** 209.178    
+
** 59.104527    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxy ferulic acid
+
** Esi_0002_0209
 +
** Esi0002_0209
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-3422]]
+
* Reaction: [[1.14.11.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-1121]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6098898}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=6101283}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
+
{{#set: centisome position=59.104527   }}
−
* HMDB : HMDB35484
+
{{#set: common name=Esi_0002_0209|Esi0002_0209}}
−
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
+
{{#set: reaction associated=1.14.11.2-RXN}}
−
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
+
−
{{#set: common name=5-hydroxyferulate}}
+
−
{{#set: molecular weight=209.178   }}
+
−
{{#set: common name=5-hydroxy ferulic acid}}
+
−
{{#set: consumed by=RXN-3422}}
+
−
{{#set: produced by=RXN-1121}}
+

Latest revision as of 19:58, 21 March 2018

Gene Ec-01_007120

  • left end position:
    • 6098898
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6101283
  • centisome position:
    • 59.104527
  • Synonym(s):
    • Esi_0002_0209
    • Esi0002_0209

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_007120&oldid=30613"