Difference between revisions of "RXN-17627"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17627 RXN-17627] == * direction: ** LEFT-TO-RIGHT * common name: ** Monooxygenase, FAD-binding...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17627 RXN-17627] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M
+
 
* common name:
 
* common name:
−
** β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)
+
** Monooxygenase, FAD-binding
−
* molecular weight:
+
** Aromatic-ring hydroxylase-like
−
** 1012.461   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-16602]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[ACETOL]][c] '''=>''' 1 [[METHYL-GLYOXAL]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 acetol[c] '''=>''' 1 methylglyoxal[c] '''+''' 2 H2O[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-26_003280]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_001320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-01_010880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5451]], acetone degradation I (to methylglyoxal): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5451 PWY-5451]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820528 91820528]
+
{{#set: common name=Monooxygenase, FAD-binding}}
−
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C}}
+
{{#set: common name=Aromatic-ring hydroxylase-like}}
−
{{#set: inchi key=InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M}}
+
{{#set: ec number=EC-1.14.14.1}}
−
{{#set: common name=β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)}}
+
{{#set: gene associated=Ec-26_003280|Ec-00_001320|Ec-01_010880}}
−
{{#set: molecular weight=1012.461    }}
+
{{#set: in pathway=PWY-5451}}
−
{{#set: produced by=RXN-16602}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:58, 21 March 2018

Reaction RXN-17627

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Monooxygenase, FAD-binding
    • Aromatic-ring hydroxylase-like
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5451, acetone degradation I (to methylglyoxal): PWY-5451
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17627&oldid=30649"