Difference between revisions of "Cis-delta7-3-hydroxycerotoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta7-3-hydroxycerotoyl-ACPs cis-delta7-3-hydroxycerotoyl-ACPs] == * common name: ** a cis...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta7-3-hydroxycerotoyl-ACPs cis-delta7-3-hydroxycerotoyl-ACPs] ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
* inchi key:
+
** InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
+
** a cis-delta7-3-hydroxyC26:1-[acp]
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
** 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
 
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
 
** 4α-methylfecosterol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4144]]
+
* [[RXN1G-364]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-delta7-3-hydroxyC26:1-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193524 193524]
+
{{#set: produced by=RXN1G-364}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80094 80094]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15776 C15776]
+
* HMDB : HMDB06845
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N}}
+
{{#set: common name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol|4α-methyl-5α-ergosta-8,24-dien-3β-ol|4α-methylfecosterol}}
+
{{#set: produced by=RXN-4144}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite cis-delta7-3-hydroxycerotoyl-ACPs

  • common name:
    • a cis-delta7-3-hydroxyC26:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta7-3-hydroxyC26:1-[acp" cannot be used as a page name in this wiki.