Difference between revisions of "Ec-15 000240"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.9-RXN 6.3.4.9-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Biotin/lipoate A/B prot...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * smiles: ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) * inchi key...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == |
− | * | + | * smiles: |
− | ** | + | ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=IVOMOUWHDPKRLL-KQYNXXCUSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** cyclic-AMP |
− | * | + | * molecular weight: |
− | + | ** 328.201 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** cyclic 3',5'-AMP | ||
+ | ** 3',5'-cyclic AMP | ||
+ | ** adenosine cyclic-3',5'-monophosphate | ||
+ | ** adenosine cyclic-monophosphate | ||
+ | ** adenosine-cyclic-phosphoric-acid | ||
+ | ** cAMP | ||
+ | ** adenosine-cyclic-phosphate | ||
+ | ** adenosine-3',5'-monophosphate | ||
+ | ** adenosine 3',5'-cyclic phosphate | ||
+ | ** adenosine-3',5'-cyclic monophosphate | ||
+ | ** cyclic-3',5'-adenosine monophosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[ADENYLATECYC-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * CAS : 60-92-4 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * BIGG : 1484809 |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059571 7059571] | |
− | + | * HMDB : HMDB00058 | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00575 C00575] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5415746.html 5415746] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58165 58165] |
+ | * METABOLIGHTS : MTBLC58165 | ||
+ | {{#set: smiles=C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34))))}} | ||
+ | {{#set: inchi key=InChIKey=IVOMOUWHDPKRLL-KQYNXXCUSA-M}} | ||
+ | {{#set: common name=cyclic-AMP}} | ||
+ | {{#set: molecular weight=328.201 }} | ||
+ | {{#set: common name=cyclic 3',5'-AMP|3',5'-cyclic AMP|adenosine cyclic-3',5'-monophosphate|adenosine cyclic-monophosphate|adenosine-cyclic-phosphoric-acid|cAMP|adenosine-cyclic-phosphate|adenosine-3',5'-monophosphate|adenosine 3',5'-cyclic phosphate|adenosine-3',5'-cyclic monophosphate|cyclic-3',5'-adenosine monophosphate}} | ||
+ | {{#set: produced by=ADENYLATECYC-RXN}} |
Revision as of 21:55, 17 March 2018
Contents
Metabolite CAMP
- smiles:
- C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34))))
- inchi key:
- InChIKey=IVOMOUWHDPKRLL-KQYNXXCUSA-M
- common name:
- cyclic-AMP
- molecular weight:
- 328.201
- Synonym(s):
- cyclic 3',5'-AMP
- 3',5'-cyclic AMP
- adenosine cyclic-3',5'-monophosphate
- adenosine cyclic-monophosphate
- adenosine-cyclic-phosphoric-acid
- cAMP
- adenosine-cyclic-phosphate
- adenosine-3',5'-monophosphate
- adenosine 3',5'-cyclic phosphate
- adenosine-3',5'-cyclic monophosphate
- cyclic-3',5'-adenosine monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 60-92-4
- BIGG : 1484809
- PUBCHEM:
- HMDB : HMDB00058
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58165
"C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34))))" cannot be used as a page name in this wiki.