Difference between revisions of "Octapeptides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octapeptides Octapeptides] == * common name: ** an octapeptide * Synonym(s): == Reaction(s) kn...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octapeptides Octapeptides] ==
* smiles:
+
** C([N+])CCCC([N+])C([O-])=O
+
* inchi key:
+
** InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O
+
 
* common name:
 
* common name:
** L-lysine
+
** an octapeptide
* molecular weight:
+
** 147.197   
+
 
* Synonym(s):
 
* Synonym(s):
** K
 
** lysine
 
** L-lys
 
** lys
 
** 2,6-diaminohexanoic acid
 
** lysine acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1961]]
 
* [[LYSINE--TRNA-LIGASE-RXN]]
 
* [[biomass_rxn]]
 
* [[1.5.1.8-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMDECARB-RXN]]
+
* [[3.4.24.59-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 56-87-1
+
{{#set: common name=an octapeptide}}
* BIGG : 33655
+
{{#set: produced by=3.4.24.59-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460926 5460926]
+
* HMDB : HMDB00182
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00047 C00047]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32551 32551]
+
* METABOLIGHTS : MTBLC32551
+
{{#set: smiles=C([N+])CCCC([N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O}}
+
{{#set: common name=L-lysine}}
+
{{#set: molecular weight=147.197    }}
+
{{#set: common name=K|lysine|L-lys|lys|2,6-diaminohexanoic acid|lysine acid}}
+
{{#set: consumed by=RXN-1961|LYSINE--TRNA-LIGASE-RXN|biomass_rxn|1.5.1.8-RXN}}
+
{{#set: produced by=DIAMINOPIMDECARB-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite Octapeptides

  • common name:
    • an octapeptide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links