Difference between revisions of "Poly-Gamma-Glutamylcysteine-Glycines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] == * common name: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a poly-[γ-glutamylcysteine]-glycine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a phytochelatin |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.3.2.15-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.3.2.15-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a poly-[γ-glutamylcysteine]-glycine}} | |
− | + | {{#set: common name=a phytochelatin}} | |
− | + | {{#set: consumed by=2.3.2.15-RXN}} | |
− | + | {{#set: produced by=2.3.2.15-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite Poly-Gamma-Glutamylcysteine-Glycines
- common name:
- a poly-[γ-glutamylcysteine]-glycine
- Synonym(s):
- a phytochelatin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a poly-[γ-glutamylcysteine]-glycine" cannot be used as a page name in this wiki.