Difference between revisions of "S-ubiquitinyl-HECT-E3-UCP-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-HECT-E3-UCP-L-cysteine S-ubiquitinyl-HECT-E3-UCP-L-cysteine] == * common name: **...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-HECT-E3-UCP-L-cysteine S-ubiquitinyl-HECT-E3-UCP-L-cysteine] ==
−
* smiles:
+
−
** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
+
−
* inchi key:
+
−
** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
+
 
* common name:
 
* common name:
−
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
+
** an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine
−
* molecular weight:
+
−
** 223.234   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15733]]
+
* [[RXN-15560]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15559]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804]
+
{{#set: consumed by=RXN-15560}}
−
{{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: produced by=RXN-15559}}
−
{{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}}
+
−
{{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
+
−
{{#set: molecular weight=223.234    }}
+
−
{{#set: consumed by=RXN-15733}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite S-ubiquitinyl-HECT-E3-UCP-L-cysteine

  • common name:
    • an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=S-ubiquitinyl-HECT-E3-UCP-L-cysteine&oldid=30856"