Difference between revisions of "CPD-6746"

Latest revision as of 20:00, 21 March 2018

"C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=11Z-3-oxo-icos-11-enoyl-ACPs 11Z-3-oxo-icos-11-enoyl-ACPs] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] ==
+* smiles:
+** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
+* inchi key:
+** InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
 * common name:
-** an (11Z)-3-oxo-icos-11-enoyl-[acp]
+** 1D-myo-inositol 2-monophosphate
+* molecular weight:
+** 258.121
 * Synonym(s):
+** D-myo-inositol 2-monophosphate
+** Ins(2)P1
+** Ins(2)P
+** Ins2P
 == Reaction(s) known to consume the compound ==
-* [[RXN-16630]]
+* [[RXN-7253]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16629]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=an (11Z)-3-oxo-icos-11-enoyl-[acp]}}
+* CHEBI:
-{{#set: consumed by=RXN-16630}}
+** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62383 62383]
-{{#set: produced by=RXN-16629}}
+{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)}}
+{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L}}
+{{#set: common name=1D-myo-inositol 2-monophosphate}}
+{{#set: molecular weight=258.121    }}
+{{#set: common name=D-myo-inositol 2-monophosphate|Ins(2)P1|Ins(2)P|Ins2P}}
+{{#set: consumed by=RXN-7253}}