Difference between revisions of "PWY-6534"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * smiles: ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-18_003590 == * left end position: ** 3557788 * transcription direction: ** POSITIVE * right end position: ** 3561088 * centisome position: ** 72.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_003590 == |
− | * | + | * left end position: |
− | ** | + | ** 3557788 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3561088 |
− | * | + | * centisome position: |
− | ** | + | ** 72.216515 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0022_0120 |
− | ** | + | ** Esi0022_0120 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3557788}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3561088}} | |
− | + | {{#set: centisome position=72.216515 }} | |
− | + | {{#set: common name=Esi_0022_0120|Esi0022_0120}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 20:56, 17 March 2018
Gene Ec-18_003590
- left end position:
- 3557788
- transcription direction:
- POSITIVE
- right end position:
- 3561088
- centisome position:
- 72.216515
- Synonym(s):
- Esi_0022_0120
- Esi0022_0120
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome