Difference between revisions of "GLUTAMIDOTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** L-isoleucine biosynthesis I (from threonine) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''7''' reactions found over '''7''' reactions in the full pathway | |
− | * [[RXN- | + | * [[ACETOOHBUTREDUCTOISOM-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | + | *** [[Ec-09_003170]] | |
− | * [[RXN- | + | ** 1 reconstruction source(s) associated: |
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[ACETOOHBUTSYN-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Ec-12_005560]] | ||
+ | *** [[Ec-20_001390]] | ||
+ | *** [[Ec-12_005530]] | ||
+ | *** [[Ec-01_007170]] | ||
+ | *** [[Ec-12_005520]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[DIHYDROXYMETVALDEHYDRAT-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-03_000220]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-15121]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-15122]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-06_007490]] | ||
+ | *** [[Ec-03_001910]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-15123]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=L-isoleucine biosynthesis I (from threonine)}} | |
− | + | {{#set: reaction found=7}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 20:57, 17 March 2018
Pathway ILEUSYN-PWY
- taxonomic range:
- common name:
- L-isoleucine biosynthesis I (from threonine)
- Synonym(s):
Reaction(s) found
7 reactions found over 7 reactions in the full pathway
- ACETOOHBUTREDUCTOISOM-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- ACETOOHBUTSYN-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- BRANCHED-CHAINAMINOTRANSFERILEU-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- DIHYDROXYMETVALDEHYDRAT-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-15121
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15122
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-15123
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: