Difference between revisions of "Ec-19 003370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
 
(Created page with "Category:Gene == Gene Ec-14_002880 == * left end position: ** 2716138 * transcription direction: ** NEGATIVE * right end position: ** 2719265 * centisome position: ** 41.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
+
== Gene Ec-14_002880 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
+
** 2716138
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
** 2719265
−
* molecular weight:
+
* centisome position:
−
** 443.688    
+
** 41.401844    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0089_0031
 +
** Esi0089_0031
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-18]]
+
* [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
* [[RXN-14240]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-15288]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-17352]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-8635]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2716138}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202943 25202943]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB12165
+
{{#set: right end position=2719265}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: centisome position=41.401844    }}
−
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
+
{{#set: common name=Esi_0089_0031|Esi0089_0031}}
−
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
{{#set: molecular weight=443.688    }}
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
{{#set: consumed by=RXN66-18}}
+

Revision as of 21:01, 17 March 2018

Gene Ec-14_002880

  • left end position:
    • 2716138
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2719265
  • centisome position:
    • 41.401844
  • Synonym(s):
    • Esi_0089_0031
    • Esi0089_0031

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_003370&oldid=11308"