Difference between revisions of "Ec-08 000940"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_ADENOSYLCOBALAMIN TransportSeed_ADENOSYLCOBALAMIN] == * direction: ** LEFT-TO-RIGHT *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_ADENOSYLCOBALAMIN TransportSeed_ADENOSYLCOBALAMIN] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
−
* common name:
+
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
−
* molecular weight:
+
−
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-13]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ADENOSYLCOBALAMIN]][e] '''=>''' 1.0 [[ADENOSYLCOBALAMIN]][c]
−
* [[RXN66-12]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 adenosylcobalamin[e] '''=>''' 1.0 adenosylcobalamin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203343 25203343]
+
{{#set: in pathway=}}
−
* HMDB : HMDB12159
+
{{#set: reconstruction category=manual}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: reconstruction source=manual-import_from_medium}}
−
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
−
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
−
{{#set: molecular weight=442.724    }}
+
−
{{#set: consumed by=RXN66-13}}
+
−
{{#set: produced by=RXN66-12}}
+

Revision as of 21:02, 17 March 2018

Reaction TransportSeed_ADENOSYLCOBALAMIN

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_000940&oldid=11339"