Difference between revisions of "2.7.1.148-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE-12-DIOXYGENASE-RXN HOMOGENTISATE-12-DIOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5))) |
+ | * inchi key: | ||
+ | ** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** delphinidin 3,5-di-O-β-D-glucoside |
− | * | + | * molecular weight: |
− | ** | + | ** 626.524 |
* Synonym(s): | * Synonym(s): | ||
+ | ** delphinidin-3,5-diglucoside | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8228]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312] |
− | + | * HMDB : HMDB30693 | |
− | {{#set: | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}} |
− | + | {{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}} | |
− | {{#set: | + | {{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}} |
− | {{#set: | + | {{#set: molecular weight=626.524 }} |
− | {{#set: | + | {{#set: common name=delphinidin-3,5-diglucoside}} |
− | {{#set: | + | {{#set: produced by=RXN-8228}} |
− | {{#set: | + |
Revision as of 20:25, 17 March 2018
Contents
Metabolite CPD-7139
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
- inchi key:
- InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
- common name:
- delphinidin 3,5-di-O-β-D-glucoside
- molecular weight:
- 626.524
- Synonym(s):
- delphinidin-3,5-diglucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))" cannot be used as a page name in this wiki.