Difference between revisions of "B-ALANINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * smiles: ** C(C([O-])=O)C(=O)C([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17753 RXN-17753] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17753 RXN-17753] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CARBAMOYL-P]][c] '''=>''' 1 [[CPD-69]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] |
| − | + | * With common name(s): | |
| − | = | + | ** 1 carbamoyl phosphate[c] '''=>''' 1 cyanate[c] '''+''' 1 H+[c] '''+''' 1 phosphate[c] |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | == Pathways == | |
| − | + | == Reconstruction information == | |
| − | * [[ | + | * Category: [[annotation]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | * [[ | + | *** Tool: [[pathwaytools]] |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 21:02, 17 March 2018
Contents
Reaction RXN-17753
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CARBAMOYL-P[c] => 1 CPD-69[c] + 1 PROTON[c] + 1 Pi[c]
- With common name(s):
- 1 carbamoyl phosphate[c] => 1 cyanate[c] + 1 H+[c] + 1 phosphate[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
