Difference between revisions of "PWY-7432"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == * smiles: ** C([O-])(=O)C1(CC1)[N+] * inchi key: ** InChIKey=PAJPWUMXBYXFCZ-U...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] ==
−
* smiles:
+
* taxonomic range:
−
** C([O-])(=O)C1(CC1)[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 1-aminocyclopropane-1-carboxylate
+
** (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)
−
* molecular weight:
+
−
** 101.105   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-aminocyclopropane-1-carboxylic acid
 
−
** ACC
 
−
** 1-aminocyclopropanecarboxylic acid
 
−
** 1-aminocyclopropanecarboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[4.1.99.4-RXN]]
+
'''13''' reactions found over '''13''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-16079]]
−
* [[4.4.1.14-RXN]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[RXN-15149]]
+
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16081]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16112]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16113]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16114]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17109]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17110]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17111]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17112]]
 +
** 1 associated gene(s):
 +
*** [[Ec-24_002300]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17113]]
 +
** 3 associated gene(s):
 +
*** [[Ec-08_006390]]
 +
*** [[Ec-22_002920]]
 +
*** [[Ec-26_004320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17114]]
 +
** 4 associated gene(s):
 +
*** [[Ec-06_001380]]
 +
*** [[Ec-16_001250]]
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-16_003560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17115]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-17116]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 22059-21-8
+
{{#set: taxonomic range=TAX-2759}}
−
* PUBCHEM:
+
{{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971063 6971063]
+
{{#set: reaction found=13}}
−
* HMDB : HMDB36458
+
{{#set: total reaction=13}}
−
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01234 C01234]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58360 58360]
+
−
* METABOLIGHTS : MTBLC58360
+
−
{{#set: smiles=C([O-])(=O)C1(CC1)[N+]}}
+
−
{{#set: inchi key=InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N}}
+
−
{{#set: common name=1-aminocyclopropane-1-carboxylate}}
+
−
{{#set: molecular weight=101.105    }}
+
−
{{#set: common name=1-aminocyclopropane-1-carboxylic acid|ACC|1-aminocyclopropanecarboxylic acid|1-aminocyclopropanecarboxylate}}
+
−
{{#set: consumed by=4.1.99.4-RXN}}
+
−
{{#set: produced by=4.4.1.14-RXN}}
+
−
{{#set: consumed or produced by=RXN-15149}}
+

Revision as of 21:03, 17 March 2018

Pathway PWY-7726

  • taxonomic range:
  • common name:
    • (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)
  • Synonym(s):

Reaction(s) found

13 reactions found over 13 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7432&oldid=11411"