Difference between revisions of "PWY-5030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
 
(Created page with "Category:Gene == Gene Ec-01_011640 == * left end position: ** 9724472 * transcription direction: ** POSITIVE * right end position: ** 9733524 * centisome position: ** 94.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Gene Ec-01_011640 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
+
** 9724472
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** delphinidin 3,5-di-O-β-D-glucoside
+
** 9733524
−
* molecular weight:
+
* centisome position:
−
** 626.524    
+
** 94.24003    
 
* Synonym(s):
 
* Synonym(s):
−
** delphinidin-3,5-diglucoside
+
** Esi_0008_0113
 +
** Esi0008_0113
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[INORGPYROPHOSPHAT-RXN]]
−
* [[RXN-8228]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=9724472}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=9733524}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
+
{{#set: centisome position=94.24003   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0008_0113|Esi0008_0113}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
+
{{#set: reaction associated=INORGPYROPHOSPHAT-RXN}}
−
* HMDB : HMDB30693
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
+
−
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
+
−
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
+
−
{{#set: molecular weight=626.524   }}
+
−
{{#set: common name=delphinidin-3,5-diglucoside}}
+
−
{{#set: produced by=RXN-8228}}
+

Revision as of 20:26, 17 March 2018

Gene Ec-01_011640

  • left end position:
    • 9724472
  • transcription direction:
    • POSITIVE
  • right end position:
    • 9733524
  • centisome position:
    • 94.24003
  • Synonym(s):
    • Esi_0008_0113
    • Esi0008_0113

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5030&oldid=8887"