|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-COA-HYDRAT-RXN ENOYL-COA-HYDRAT-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SORBITOL SORBITOL] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(C(C(C(C(CO)O)O)O)O)O |
| + | * inchi key: |
| + | ** InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N |
| * common name: | | * common name: |
− | ** ClpP/crotonase-like domain | + | ** D-sorbitol |
− | ** enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase | + | * molecular weight: |
− | ** Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
| + | ** 182.173 |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** L-gulitol |
| + | ** D-glucitol |
| + | ** meglumine |
| + | ** iso-sorbide |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[TRANS-D2-ENOYL-COA]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-3-HYDROXYACYL-COA]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-7644]] |
− | ** 1 a trans-2-enoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 a (3S)-3-hydroxyacyl-CoA[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-14_006530]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Ec-16_001250]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-16_003560]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-06_001380]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-5136]], fatty acid β-oxidation II (peroxisome): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5136 PWY-5136]
| + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7007]], methyl ketone biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007]
| + | |
− | ** '''3''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5138]], unsaturated, even numbered fatty acid β-oxidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[FAO-PWY]], fatty acid β-oxidation I: [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY66-391]], fatty acid β-oxidation VI (peroxisome): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-391 PWY66-391]
| + | |
− | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[annotation]]: | + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 50-70-4 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16105 16105]
| + | * BIGG : 36018 |
− | * LIGAND-RXN:
| + | * DRUGBANK : DB01638 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R02685 R02685]
| + | * PUBCHEM: |
− | * PIR: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5780 5780] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T17476 T17476] | + | * HMDB : HMDB00247 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T10464 T10464] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S72706 S72706] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00794 C00794] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S57651 S57651]
| + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S54786 S54786]
| + | ** [http://www.chemspider.com/Chemical-Structure.5576.html 5576] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41006 S41006] | + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S36678 S36678] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17924 17924] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S32607 S32607]
| + | * METABOLIGHTS : MTBLC17924 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S06477 S06477] | + | {{#set: smiles=C(C(C(C(C(CO)O)O)O)O)O}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0199 JX0199] | + | {{#set: inchi key=InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40678 I40678] | + | {{#set: common name=D-sorbitol}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I37195 I37195]
| + | {{#set: molecular weight=182.173 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G69985 G69985] | + | {{#set: common name=L-gulitol|D-glucitol|meglumine|iso-sorbide}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E70893 E70893] | + | {{#set: reversible reaction associated=RXN-7644}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DWRTEP DWRTEP]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D70893 D70893]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D64890 D64890] | + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C71435 C71435]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C69893 C69893]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C69370 C69370]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C69304 C69304]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A49613 A49613]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A39592 A39592]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/P21177 P21177]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08426 Q08426]
| + | |
− | ** [http://www.uniprot.org/uniprot/O29814 O29814]
| + | |
− | ** [http://www.uniprot.org/uniprot/O29299 O29299]
| + | |
− | ** [http://www.uniprot.org/uniprot/O34893 O34893]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23520 O23520]
| + | |
− | ** [http://www.uniprot.org/uniprot/P76082 P76082]
| + | |
− | ** [http://www.uniprot.org/uniprot/P64016 P64016]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07896 P07896]
| + | |
− | ** [http://www.uniprot.org/uniprot/O53419 O53419]
| + | |
− | ** [http://www.uniprot.org/uniprot/P94549 P94549]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q13825 Q13825]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45361 P45361]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28793 P28793]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14604 P14604]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22414 P22414]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0E0 Q7M0E0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34559 P34559]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01373 Q01373]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55100 P55100]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53526 P53526]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39659 Q39659]
| + | |
− | ** [http://www.uniprot.org/uniprot/O52797 O52797]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=ClpP/crotonase-like domain}} | + | |
− | {{#set: common name=enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase}}
| + | |
− | {{#set: common name=Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ}} | + | |
− | {{#set: ec number=EC-4.2.1.17}} | + | |
− | {{#set: gene associated=Ec-14_006530|Ec-16_001250|Ec-16_003560|Ec-06_001380}} | + | |
− | {{#set: in pathway=PWY-5136|PWY-7007|PWY-5138|FAO-PWY|PWY66-391}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |