Difference between revisions of "3-DEHYDRO-SHIKIMATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_001010 == * Synonym(s): ** Esi_0040_0046 ** Esi0040_0046 == Reactions associated == * ATPASE-RXN ** pantograph-aragem == Pathways...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == * smiles: ** CC(C(O)(CC(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == |
+ | * smiles: | ||
+ | ** CC(C(O)(CC(=O)[O-])C([O-])=O)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=BITYXLXUCSKTJS-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** (2S)-2-isopropylmalate | ||
+ | * molecular weight: | ||
+ | ** 174.153 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-hydroxy-4-methyl-3-carboxypentanoate |
− | ** | + | ** 3-carboxy-3-hydroxy-4-methylpentanoate |
+ | ** 3-carboxy-3-hydroxy-isocaproate | ||
+ | ** α-isopropylmalate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[2-ISOPROPYLMALATESYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
+ | * [[3-ISOPROPYLMALISOM-RXN]] | ||
+ | * [[RXN-13163]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419726 6419726] |
+ | * HMDB : HMDB00402 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02504 C02504] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4925359.html 4925359] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28107 28107] | ||
+ | * BIGG : 39972 | ||
+ | {{#set: smiles=CC(C(O)(CC(=O)[O-])C([O-])=O)C}} | ||
+ | {{#set: inchi key=InChIKey=BITYXLXUCSKTJS-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=(2S)-2-isopropylmalate}} | ||
+ | {{#set: molecular weight=174.153 }} | ||
+ | {{#set: common name=3-hydroxy-4-methyl-3-carboxypentanoate|3-carboxy-3-hydroxy-4-methylpentanoate|3-carboxy-3-hydroxy-isocaproate|α-isopropylmalate}} | ||
+ | {{#set: produced by=2-ISOPROPYLMALATESYN-RXN}} | ||
+ | {{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-13163}} |
Revision as of 21:05, 17 March 2018
Contents
Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE
- smiles:
- CC(C(O)(CC(=O)[O-])C([O-])=O)C
- inchi key:
- InChIKey=BITYXLXUCSKTJS-UHFFFAOYSA-L
- common name:
- (2S)-2-isopropylmalate
- molecular weight:
- 174.153
- Synonym(s):
- 3-hydroxy-4-methyl-3-carboxypentanoate
- 3-carboxy-3-hydroxy-4-methylpentanoate
- 3-carboxy-3-hydroxy-isocaproate
- α-isopropylmalate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(O)(CC(=O)[O-])C([O-])=O)C" cannot be used as a page name in this wiki.