Difference between revisions of "GAP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...") |
(Created page with "Category:Gene == Gene Ec-06_007870 == * left end position: ** 5533858 * transcription direction: ** POSITIVE * right end position: ** 5545396 * centisome position: ** 63.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_007870 == |
− | * | + | * left end position: |
− | ** | + | ** 5533858 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5545396 |
− | * | + | * centisome position: |
− | ** | + | ** 63.18807 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0028_0097 |
− | ** | + | ** Esi0028_0097 |
− | ** | + | ** CAMK |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5533858}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5545396}} | |
− | + | {{#set: centisome position=63.18807 }} | |
− | + | {{#set: common name=Esi_0028_0097|Esi0028_0097|CAMK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:05, 17 March 2018
Gene Ec-06_007870
- left end position:
- 5533858
- transcription direction:
- POSITIVE
- right end position:
- 5545396
- centisome position:
- 63.18807
- Synonym(s):
- Esi_0028_0097
- Esi0028_0097
- CAMK
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome