Difference between revisions of "RXN-8668"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...")
 
(Created page with "Category:Gene == Gene Ec-28_000520 == * Synonym(s): ** Esi_0098_0007 ** Esi0098_0007 ** APRT-like == Reactions associated == * ADENPRIBOSYLTRAN-RXN ** pantograph-...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+
== Gene Ec-28_000520 ==
* smiles:
+
** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))
+
* inchi key:
+
** InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M
+
* common name:
+
** unsaturated gellan tetrasaccharide
+
* molecular weight:
+
** 645.544   
+
 
* Synonym(s):
 
* Synonym(s):
** β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
+
** Esi_0098_0007
 +
** Esi0098_0007
 +
** APRT-like
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12270]]
+
* [[ADENPRIBOSYLTRAN-RXN]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[aragem]]
== Reaction(s) of unknown directionality ==
+
* [[RXN-14270]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[PWY-6605]]
 +
* [[P121-PWY]]
 +
* [[PWY-6610]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0098_0007|Esi0098_0007|APRT-like}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940141 52940141]
+
{{#set: reaction associated=ADENPRIBOSYLTRAN-RXN|RXN-14270}}
* CHEBI:
+
{{#set: pathway associated=PWY-6605|P121-PWY|PWY-6610}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63254 63254]
+
{{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))}}
+
{{#set: inchi key=InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M}}
+
{{#set: common name=unsaturated gellan tetrasaccharide}}
+
{{#set: molecular weight=645.544    }}
+
{{#set: common name=β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}}
+
{{#set: consumed by=RXN-12270}}
+

Revision as of 21:06, 17 March 2018

Gene Ec-28_000520

  • Synonym(s):
    • Esi_0098_0007
    • Esi0098_0007
    • APRT-like

Reactions associated

Pathways associated

External links