Difference between revisions of "CANAVANINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Ec-19_003770 == * Synonym(s): ** Esi_0088_0028 ** Esi0088_0028 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
+
== Gene Ec-19_003770 ==
* smiles:
+
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
+
* inchi key:
+
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
+
* common name:
+
** L-canavanine
+
* molecular weight:
+
** 177.183   
+
 
* Synonym(s):
 
* Synonym(s):
** canavanine
+
** Esi_0088_0028
** 2-amino-4-(guanidinooxy)butyrate
+
** Esi0088_0028
** 2-amino-4-(guanidinooxy)butyric acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-34]]
+
* [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[aragem]]
* [[RXN-22]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* CAS : 543-38-4
+
{{#set: common name=Esi_0088_0028|Esi0088_0028}}
* PUBCHEM:
+
{{#set: reaction associated=RXN-8443}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
+
{{#set: pathway associated=PWY-5381}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
+
* HMDB : HMDB02706
+
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
+
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
+
{{#set: common name=L-canavanine}}
+
{{#set: molecular weight=177.183    }}
+
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
+
{{#set: consumed by=RXN-34}}
+
{{#set: produced by=RXN-22}}
+

Revision as of 20:26, 17 March 2018

Gene Ec-19_003770

  • Synonym(s):
    • Esi_0088_0028
    • Esi0088_0028

Reactions associated

Pathways associated

External links