Difference between revisions of "PWY-702"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_001610 == * left end position: ** 1086439 * transcription direction: ** POSITIVE * right end position: ** 1096761 * centisome position: ** 12.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * smiles: ** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** octoketide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 317.274 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** SEK4 |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10734]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237243 44237243] |
| − | {{#set: | + | {{#set: smiles=CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=octoketide}} |
| − | {{#set: | + | {{#set: molecular weight=317.274 }} |
| − | + | {{#set: common name=SEK4}} | |
| + | {{#set: produced by=RXN-10734}} | ||
Revision as of 21:08, 17 March 2018
Contents
Metabolite CPD-11555
- smiles:
- CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))
- inchi key:
- InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M
- common name:
- octoketide
- molecular weight:
- 317.274
- Synonym(s):
- SEK4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))" cannot be used as a page name in this wiki.
