Difference between revisions of "PWY-6520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7219 PWY-7219] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7219 PWY-7219] ==
−
* smiles:
+
* taxonomic range:
−
** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** methylacrylyl-CoA
+
** adenosine ribonucleotides de novo biosynthesis
−
* molecular weight:
+
−
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
−
** methacrylyl-CoA
 
−
** 2-methylprop-2-enoyl-CoA
 
−
** methacrylyl-coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
* [[MEPROPCOA-FAD-RXN]]
+
* [[ADENYL-KIN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 9 associated gene(s):
−
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
*** [[Ec-15_000120]]
 +
*** [[Ec-06_003080]]
 +
*** [[Ec-01_006380]]
 +
*** [[Ec-07_003680]]
 +
*** [[Ec-00_009240]]
 +
*** [[Ec-16_005090]]
 +
*** [[Ec-14_004920]]
 +
*** [[Ec-16_004100]]
 +
*** [[Ec-12_005110]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_002310]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[AMPSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_002070]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ATPSYN-RXN]]
 +
** 10 associated gene(s):
 +
*** [[Ec-06_004310]]
 +
*** [[Ec-25_001860]]
 +
*** [[Ec-06_010220]]
 +
*** [[Ec-26_003670]]
 +
*** [[Ec-27_004200]]
 +
*** [[Ec-07_006840]]
 +
*** [[Ec-07_003070]]
 +
*** [[Ec-19_003180]]
 +
*** [[Ec-27_005790]]
 +
*** [[Ec-14_007010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 6008-91-9
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7219 PWY-7219]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500]
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=adenosine ribonucleotides de novo biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460]
+
{{#set: reaction found=4}}
−
* HMDB : HMDB01011
+
{{#set: total reaction=4}}
−
{{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}}
+
−
{{#set: common name=methylacrylyl-CoA}}
+
−
{{#set: molecular weight=831.577    }}
+
−
{{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}}
+
−
{{#set: produced by=MEPROPCOA-FAD-RXN}}
+
−
{{#set: consumed or produced by=METHYLACYLYLCOA-HYDROXY-RXN}}
+

Revision as of 21:08, 17 March 2018

Pathway PWY-7219

  • taxonomic range:
  • common name:
    • adenosine ribonucleotides de novo biosynthesis
  • Synonym(s):

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6520&oldid=11810"