Difference between revisions of "RXN-1223"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15129 RXN-15129] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxal phosphate-depende...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15129 RXN-15129] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Pyridoxal phosphate-dependent transferase, major region, subdomain 1 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[CYS]][c] '''=>''' 1 [[HS]][c] '''+''' 1 [[2-AMINOACRYLATE]][c] '''+''' 1 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 L-cysteine[c] '''=>''' 1 hydrogen sulfide[c] '''+''' 1 2-aminoprop-2-enoate[c] '''+''' 1 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Ec-12_003100]] | ||
| + | ** ESILICULOSUS_GENOME | ||
| + | ***EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[LCYSDEG-PWY]], L-cysteine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=LCYSDEG-PWY LCYSDEG-PWY] | ||
| + | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Pyridoxal phosphate-dependent transferase, major region, subdomain 1}} | |
| − | {{#set: | + | {{#set: gene associated=Ec-12_003100}} |
| − | {{#set: | + | {{#set: in pathway=LCYSDEG-PWY}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 21:09, 17 March 2018
Contents
Reaction RXN-15129
- direction:
- LEFT-TO-RIGHT
- common name:
- Pyridoxal phosphate-dependent transferase, major region, subdomain 1
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CYS[c] => 1 HS[c] + 1 2-AMINOACRYLATE[c] + 1 PROTON[c]
- With common name(s):
- 1 L-cysteine[c] => 1 hydrogen sulfide[c] + 1 2-aminoprop-2-enoate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-12_003100
- ESILICULOSUS_GENOME
- EC-NUMBER
- ESILICULOSUS_GENOME
Pathways
- LCYSDEG-PWY, L-cysteine degradation II: LCYSDEG-PWY
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
