Difference between revisions of "MANNIDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * inchi key: ** InChI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7661 PWY-7661] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7661 PWY-7661] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** protein N-glycosylation (Haloferax volcanii) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''1''' reactions found over '''10''' reactions in the full pathway |
− | * [[RXN- | + | * [[RXN-16602]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[Ec-01_007940]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16595 RXN-16595] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16596 RXN-16596] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16597 RXN-16597] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16598 RXN-16598] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16599 RXN-16599] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16600 RXN-16600] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16601 RXN-16601] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-274 TRANS-RXN-274] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-275 TRANS-RXN-275] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=protein N-glycosylation (Haloferax volcanii)}} | |
− | {{#set: | + | {{#set: reaction found=1}} |
− | + | {{#set: total reaction=10}} | |
− | {{#set: common name= | + | {{#set: completion rate=10.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:10, 17 March 2018
Pathway PWY-7661
- taxonomic range:
- common name:
- protein N-glycosylation (Haloferax volcanii)
- Synonym(s):
Reaction(s) found
1 reactions found over 10 reactions in the full pathway
- RXN-16602
- 1 associated gene(s):
- 1 reconstruction source(s) associated: