Difference between revisions of "Protein-With-N-Terminal-Met"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(...")
 
(Created page with "Category:Gene == Gene Ec-02_002270 == * left end position: ** 2450529 * transcription direction: ** NEGATIVE * right end position: ** 2463596 * centisome position: ** 37.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] ==
+
== Gene Ec-02_002270 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2450529
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-oxo-docosapentaenoyl-CoA
+
** 2463596
−
* molecular weight:
+
* centisome position:
−
** 1089.98    
+
** 37.539944    
 
* Synonym(s):
 
* Synonym(s):
−
** (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA
+
** Esi_0356_0010
 +
** Esi0356_0010
 +
** CYSRS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13443]]
+
* [[CYSTEINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-13442]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2450529}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581097 71581097]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2463596}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73863 73863]
+
{{#set: centisome position=37.539944   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0356_0010|Esi0356_0010|CYSRS}}
−
{{#set: inchi key=InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J}}
+
{{#set: reaction associated=CYSTEINE--TRNA-LIGASE-RXN}}
−
{{#set: common name=3-oxo-docosapentaenoyl-CoA}}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: molecular weight=1089.98   }}
+
−
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-13443}}
+
−
{{#set: produced by=RXN-13442}}
+

Revision as of 21:12, 17 March 2018

Gene Ec-02_002270

  • left end position:
    • 2450529
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2463596
  • centisome position:
    • 37.539944
  • Synonym(s):
    • Esi_0356_0010
    • Esi0356_0010
    • CYSRS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Protein-With-N-Terminal-Met&oldid=12058"