Difference between revisions of "Ec-13 004620"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-26_000190 == * left end position: ** 376382 * transcription direction: ** NEGATIVE * right end position: ** 382141 * centisome position: ** 5.7171...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * smiles: ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (2E,11Z)-hexadec-2,11-dienoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 997.883 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16558]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958] | |
| − | {{#set: | + | {{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=997.883 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-16558}} |
Revision as of 21:13, 17 March 2018
Contents
Metabolite CPD-17813
- smiles:
- CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- inchi key:
- InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
- common name:
- (2E,11Z)-hexadec-2,11-dienoyl-CoA
- molecular weight:
- 997.883
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.
